C26H31N7 — CID 71196180
4-N-[3-(2,3-dihydropyrrol-1-yl)phenyl]-5-methyl-2-N-[4-(4-methylpiperazin-1-yl)phenyl]pyrimidine-2,4-diamine (PubChem CID 71196180) has the molecular formula C26H31N7 and a molecular weight of 441.58 g/mol. Its IUPAC name is 4-N-[3-(2,3-dihydropyrrol-1-yl)phenyl]-5-methyl-2-N-[4-(4-methylpiperazin-1-yl)phenyl]pyrimidine-2,4-diamine.
| Compound Name | 4-N-[3-(2,3-dihydropyrrol-1-yl)phenyl]-5-methyl-2-N-[4-(4-methylpiperazin-1-yl)phenyl]pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 71196180 |
| Molecular Formula | C26H31N7 |
| Molecular Weight | 441.58 g/mol |
| Exact Mass | 441.26 |
| IUPAC Name | 4-N-[3-(2,3-dihydropyrrol-1-yl)phenyl]-5-methyl-2-N-[4-(4-methylpiperazin-1-yl)phenyl]pyrimidine-2,4-diamine |
| SMILES | Cc1cnc(Nc2ccc(N3CCN(C)CC3)cc2)nc1Nc1cccc(N2C=CCC2)c1 |
| InChI | InChI=1S/C26H31N7/c1-20-19-27-26(29-21-8-10-23(11-9-21)33-16-14-31(2)15-17-33)30-25(20)28-22-6-5-7-24(18-22)32-12-3-4-13-32/h3,5-12,18-19H,4,13-17H2,1-2H3,(H2,27,28,29,30) |
| InChIKey | XWMRJSHIJHERMY-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 59.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.58 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|