C25H29N7 — CID 16722996
5-methyl-4-N-(7-methyl-1H-indol-6-yl)-2-N-[4-(4-methylpiperazin-1-yl)phenyl]pyrimidine-2,4-diamine (PubChem CID 16722996) has the molecular formula C25H29N7 and a molecular weight of 427.56 g/mol. Its IUPAC name is 5-methyl-4-N-(7-methyl-1H-indol-6-yl)-2-N-[4-(4-methylpiperazin-1-yl)phenyl]pyrimidine-2,4-diamine.
| Compound Name | 5-methyl-4-N-(7-methyl-1H-indol-6-yl)-2-N-[4-(4-methylpiperazin-1-yl)phenyl]pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 16722996 |
| Molecular Formula | C25H29N7 |
| Molecular Weight | 427.56 g/mol |
| Exact Mass | 427.25 |
| IUPAC Name | 5-methyl-4-N-(7-methyl-1H-indol-6-yl)-2-N-[4-(4-methylpiperazin-1-yl)phenyl]pyrimidine-2,4-diamine |
| SMILES | Cc1cnc(Nc2ccc(N3CCN(C)CC3)cc2)nc1Nc1ccc2cc[nH]c2c1C |
| InChI | InChI=1S/C25H29N7/c1-17-16-27-25(28-20-5-7-21(8-6-20)32-14-12-31(3)13-15-32)30-24(17)29-22-9-4-19-10-11-26-23(19)18(22)2/h4-11,16,26H,12-15H2,1-3H3,(H2,27,28,29,30) |
| InChIKey | UMSBIISOQVTTEE-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 72.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.56 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|