C24H27N7 — CID 66637307
5-(7-methyl-1H-indol-4-yl)-2-N-[4-(4-methylpiperazin-1-yl)phenyl]pyrimidine-2,4-diamine (PubChem CID 66637307) has the molecular formula C24H27N7 and a molecular weight of 413.53 g/mol. Its IUPAC name is 5-(7-methyl-1H-indol-4-yl)-2-N-[4-(4-methylpiperazin-1-yl)phenyl]pyrimidine-2,4-diamine.
| Compound Name | 5-(7-methyl-1H-indol-4-yl)-2-N-[4-(4-methylpiperazin-1-yl)phenyl]pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 66637307 |
| Molecular Formula | C24H27N7 |
| Molecular Weight | 413.53 g/mol |
| Exact Mass | 413.23 |
| IUPAC Name | 5-(7-methyl-1H-indol-4-yl)-2-N-[4-(4-methylpiperazin-1-yl)phenyl]pyrimidine-2,4-diamine |
| SMILES | Cc1ccc(-c2cnc(Nc3ccc(N4CCN(C)CC4)cc3)nc2N)c2cc[nH]c12 |
| InChI | InChI=1S/C24H27N7/c1-16-3-8-19(20-9-10-26-22(16)20)21-15-27-24(29-23(21)25)28-17-4-6-18(7-5-17)31-13-11-30(2)12-14-31/h3-10,15,26H,11-14H2,1-2H3,(H3,25,27,28,29) |
| InChIKey | CWMAEOCIEUODDG-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 86.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.53 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|