C25H25ClN6O — CID 137437129
6-(2-chlorophenyl)-5-methyl-2-[4-(4-methylpiperazin-1-yl)anilino]-8H-pyrido[2,3-d]pyrimidin-7-one (PubChem CID 137437129) has the molecular formula C25H25ClN6O and a molecular weight of 460.97 g/mol. Its IUPAC name is 6-(2-chlorophenyl)-5-methyl-2-[4-(4-methylpiperazin-1-yl)anilino]-8H-pyrido[2,3-d]pyrimidin-7-one.
| Compound Name | 6-(2-chlorophenyl)-5-methyl-2-[4-(4-methylpiperazin-1-yl)anilino]-8H-pyrido[2,3-d]pyrimidin-7-one |
|---|---|
| PubChem CID | 137437129 |
| Molecular Formula | C25H25ClN6O |
| Molecular Weight | 460.97 g/mol |
| Exact Mass | 460.18 |
| IUPAC Name | 6-(2-chlorophenyl)-5-methyl-2-[4-(4-methylpiperazin-1-yl)anilino]-8H-pyrido[2,3-d]pyrimidin-7-one |
| SMILES | Cc1c(-c2ccccc2Cl)c(=O)[nH]c2nc(Nc3ccc(N4CCN(C)CC4)cc3)ncc12 |
| InChI | InChI=1S/C25H25ClN6O/c1-16-20-15-27-25(28-17-7-9-18(10-8-17)32-13-11-31(2)12-14-32)30-23(20)29-24(33)22(16)19-5-3-4-6-21(19)26/h3-10,15H,11-14H2,1-2H3,(H2,27,28,29,30,33) |
| InChIKey | KMYLYGYSWGCPGA-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 77.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.97 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|