C26H26Cl2N6O — CID 137437143
6-(2,5-dichlorophenyl)-5-methyl-2-[3-methyl-4-(4-methylpiperazin-1-yl)anilino]-8H-pyrido[2,3-d]pyrimidin-7-one (PubChem CID 137437143) has the molecular formula C26H26Cl2N6O and a molecular weight of 509.44 g/mol. Its IUPAC name is 6-(2,5-dichlorophenyl)-5-methyl-2-[3-methyl-4-(4-methylpiperazin-1-yl)anilino]-8H-pyrido[2,3-d]pyrimidin-7-one.
| Compound Name | 6-(2,5-dichlorophenyl)-5-methyl-2-[3-methyl-4-(4-methylpiperazin-1-yl)anilino]-8H-pyrido[2,3-d]pyrimidin-7-one |
|---|---|
| PubChem CID | 137437143 |
| Molecular Formula | C26H26Cl2N6O |
| Molecular Weight | 509.44 g/mol |
| Exact Mass | 508.15 |
| IUPAC Name | 6-(2,5-dichlorophenyl)-5-methyl-2-[3-methyl-4-(4-methylpiperazin-1-yl)anilino]-8H-pyrido[2,3-d]pyrimidin-7-one |
| SMILES | Cc1cc(Nc2ncc3c(C)c(-c4cc(Cl)ccc4Cl)c(=O)[nH]c3n2)ccc1N1CCN(C)CC1 |
| InChI | InChI=1S/C26H26Cl2N6O/c1-15-12-18(5-7-22(15)34-10-8-33(3)9-11-34)30-26-29-14-20-16(2)23(25(35)31-24(20)32-26)19-13-17(27)4-6-21(19)28/h4-7,12-14H,8-11H2,1-3H3,(H2,29,30,31,32,35) |
| InChIKey | RYDJEDNNODWXBE-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 77.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.44 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|