C25H28ClN9O2 — CID 91557424
6-(2-amino-5-chlorophenyl)-2-[3-(ethylamino)-4-(4-methylpiperazin-1-yl)anilino]-8H-pyrimido[4,5-d]pyrimidine-5,7-dione (PubChem CID 91557424) has the molecular formula C25H28ClN9O2 and a molecular weight of 522.01 g/mol. Its IUPAC name is 6-(2-amino-5-chlorophenyl)-2-[3-(ethylamino)-4-(4-methylpiperazin-1-yl)anilino]-8H-pyrimido[4,5-d]pyrimidine-5,7-dione.
| Compound Name | 6-(2-amino-5-chlorophenyl)-2-[3-(ethylamino)-4-(4-methylpiperazin-1-yl)anilino]-8H-pyrimido[4,5-d]pyrimidine-5,7-dione |
|---|---|
| PubChem CID | 91557424 |
| Molecular Formula | C25H28ClN9O2 |
| Molecular Weight | 522.01 g/mol |
| Exact Mass | 521.21 |
| IUPAC Name | 6-(2-amino-5-chlorophenyl)-2-[3-(ethylamino)-4-(4-methylpiperazin-1-yl)anilino]-8H-pyrimido[4,5-d]pyrimidine-5,7-dione |
| SMILES | CCNc1cc(Nc2ncc3c(=O)n(-c4cc(Cl)ccc4N)c(=O)[nH]c3n2)ccc1N1CCN(C)CC1 |
| InChI | InChI=1S/C25H28ClN9O2/c1-3-28-19-13-16(5-7-20(19)34-10-8-33(2)9-11-34)30-24-29-14-17-22(31-24)32-25(37)35(23(17)36)21-12-15(26)4-6-18(21)27/h4-7,12-14,28H,3,8-11,27H2,1-2H3,(H2,29,30,31,32,37) |
| InChIKey | DDRXMIINJXFIGW-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 137.20 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.01 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|