C26H34N6O — CID 137436787
8-cyclohexyl-5-methyl-2-[3-methyl-4-(4-methylpiperazin-1-yl)anilino]pyrido[2,3-d]pyrimidin-7-one (PubChem CID 137436787) has the molecular formula C26H34N6O and a molecular weight of 446.60 g/mol. Its IUPAC name is 8-cyclohexyl-5-methyl-2-[3-methyl-4-(4-methylpiperazin-1-yl)anilino]pyrido[2,3-d]pyrimidin-7-one.
| Compound Name | 8-cyclohexyl-5-methyl-2-[3-methyl-4-(4-methylpiperazin-1-yl)anilino]pyrido[2,3-d]pyrimidin-7-one |
|---|---|
| PubChem CID | 137436787 |
| Molecular Formula | C26H34N6O |
| Molecular Weight | 446.60 g/mol |
| Exact Mass | 446.28 |
| IUPAC Name | 8-cyclohexyl-5-methyl-2-[3-methyl-4-(4-methylpiperazin-1-yl)anilino]pyrido[2,3-d]pyrimidin-7-one |
| SMILES | Cc1cc(Nc2ncc3c(C)cc(=O)n(C4CCCCC4)c3n2)ccc1N1CCN(C)CC1 |
| InChI | InChI=1S/C26H34N6O/c1-18-16-24(33)32(21-7-5-4-6-8-21)25-22(18)17-27-26(29-25)28-20-9-10-23(19(2)15-20)31-13-11-30(3)12-14-31/h9-10,15-17,21H,4-8,11-14H2,1-3H3,(H,27,28,29) |
| InChIKey | WHZYQWDWXKZQMV-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 66.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.60 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|