C26H34N6O — CID 10114562
8-cyclopentyl-5-methyl-2-[4-(3,3,4-trimethylpiperazin-1-yl)anilino]pyrido[2,3-d]pyrimidin-7-one (PubChem CID 10114562) has the molecular formula C26H34N6O and a molecular weight of 446.60 g/mol. Its IUPAC name is 8-cyclopentyl-5-methyl-2-[4-(3,3,4-trimethylpiperazin-1-yl)anilino]pyrido[2,3-d]pyrimidin-7-one.
| Compound Name | 8-cyclopentyl-5-methyl-2-[4-(3,3,4-trimethylpiperazin-1-yl)anilino]pyrido[2,3-d]pyrimidin-7-one |
|---|---|
| PubChem CID | 10114562 |
| Molecular Formula | C26H34N6O |
| Molecular Weight | 446.60 g/mol |
| Exact Mass | 446.28 |
| IUPAC Name | 8-cyclopentyl-5-methyl-2-[4-(3,3,4-trimethylpiperazin-1-yl)anilino]pyrido[2,3-d]pyrimidin-7-one |
| SMILES | Cc1cc(=O)n(C2CCCC2)c2nc(Nc3ccc(N4CCN(C)C(C)(C)C4)cc3)ncc12 |
| InChI | InChI=1S/C26H34N6O/c1-18-15-23(33)32(21-7-5-6-8-21)24-22(18)16-27-25(29-24)28-19-9-11-20(12-10-19)31-14-13-30(4)26(2,3)17-31/h9-12,15-16,21H,5-8,13-14,17H2,1-4H3,(H,27,28,29) |
| InChIKey | VLKGRHVKMIJVGP-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 66.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.60 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|