C25H29F3N6O — CID 139969358
8-cyclopentyl-2-[4-(3,5-dimethylpiperazin-1-yl)anilino]-5-(trifluoromethyl)pyrido[2,3-d]pyrimidin-7-one (PubChem CID 139969358) has the molecular formula C25H29F3N6O and a molecular weight of 486.54 g/mol. Its IUPAC name is 8-cyclopentyl-2-[4-(3,5-dimethylpiperazin-1-yl)anilino]-5-(trifluoromethyl)pyrido[2,3-d]pyrimidin-7-one.
| Compound Name | 8-cyclopentyl-2-[4-(3,5-dimethylpiperazin-1-yl)anilino]-5-(trifluoromethyl)pyrido[2,3-d]pyrimidin-7-one |
|---|---|
| PubChem CID | 139969358 |
| Molecular Formula | C25H29F3N6O |
| Molecular Weight | 486.54 g/mol |
| Exact Mass | 486.24 |
| IUPAC Name | 8-cyclopentyl-2-[4-(3,5-dimethylpiperazin-1-yl)anilino]-5-(trifluoromethyl)pyrido[2,3-d]pyrimidin-7-one |
| SMILES | CC1CN(c2ccc(Nc3ncc4c(C(F)(F)F)cc(=O)n(C5CCCC5)c4n3)cc2)CC(C)N1 |
| InChI | InChI=1S/C25H29F3N6O/c1-15-13-33(14-16(2)30-15)18-9-7-17(8-10-18)31-24-29-12-20-21(25(26,27)28)11-22(35)34(23(20)32-24)19-5-3-4-6-19/h7-12,15-16,19,30H,3-6,13-14H2,1-2H3,(H,29,31,32) |
| InChIKey | ZGYUAHGVIXLJOA-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 75.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.54 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|