C25H28BrF3N6O — CID 10166653
6-bromo-8-cyclopentyl-5-methyl-2-[4-[4-(2,2,2-trifluoroethyl)piperazin-1-yl]anilino]pyrido[2,3-d]pyrimidin-7-one (PubChem CID 10166653) has the molecular formula C25H28BrF3N6O and a molecular weight of 565.44 g/mol. Its IUPAC name is 6-bromo-8-cyclopentyl-5-methyl-2-[4-[4-(2,2,2-trifluoroethyl)piperazin-1-yl]anilino]pyrido[2,3-d]pyrimidin-7-one.
| Compound Name | 6-bromo-8-cyclopentyl-5-methyl-2-[4-[4-(2,2,2-trifluoroethyl)piperazin-1-yl]anilino]pyrido[2,3-d]pyrimidin-7-one |
|---|---|
| PubChem CID | 10166653 |
| Molecular Formula | C25H28BrF3N6O |
| Molecular Weight | 565.44 g/mol |
| Exact Mass | 564.15 |
| IUPAC Name | 6-bromo-8-cyclopentyl-5-methyl-2-[4-[4-(2,2,2-trifluoroethyl)piperazin-1-yl]anilino]pyrido[2,3-d]pyrimidin-7-one |
| SMILES | Cc1c(Br)c(=O)n(C2CCCC2)c2nc(Nc3ccc(N4CCN(CC(F)(F)F)CC4)cc3)ncc12 |
| InChI | InChI=1S/C25H28BrF3N6O/c1-16-20-14-30-24(32-22(20)35(23(36)21(16)26)19-4-2-3-5-19)31-17-6-8-18(9-7-17)34-12-10-33(11-13-34)15-25(27,28)29/h6-9,14,19H,2-5,10-13,15H2,1H3,(H,30,31,32) |
| InChIKey | SESGSMIRXCYAHD-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 66.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.44 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|