About 1-cyclopentyl-6-(4-morpholin-4-ylanilino)-2H-pyrazolo[3,4-d]pyrimidin-3-one
1-cyclopentyl-6-(4-morpholin-4-ylanilino)-2H-pyrazolo[3,4-d]pyrimidin-3-one (PubChem CID 59686676) has the molecular formula C20H24N6O2
and a molecular weight of 380.45 g/mol. Its IUPAC name is 1-cyclopentyl-6-(4-morpholin-4-ylanilino)-2H-pyrazolo[3,4-d]pyrimidin-3-one.
Molecular Properties
| Compound Name | 1-cyclopentyl-6-(4-morpholin-4-ylanilino)-2H-pyrazolo[3,4-d]pyrimidin-3-one |
| PubChem CID | 59686676 |
| Molecular Formula | C20H24N6O2 |
| Molecular Weight | 380.45 g/mol |
| Exact Mass | 380.20 |
| IUPAC Name | 1-cyclopentyl-6-(4-morpholin-4-ylanilino)-2H-pyrazolo[3,4-d]pyrimidin-3-one |
| SMILES | O=c1[nH]n(C2CCCC2)c2nc(Nc3ccc(N4CCOCC4)cc3)ncc12 |
| InChI | InChI=1S/C20H24N6O2/c27-19-17-13-21-20(23-18(17)26(24-19)16-3-1-2-4-16)22-14-5-7-15(8-6-14)25-9-11-28-12-10-25/h5-8,13,16H,1-4,9-12H2,(H,24,27)(H,21,22,23) |
| InChIKey | NESBVBBVKUDXFD-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 88.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 380.45 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|
Analyze 1-cyclopentyl-6-(4-morpholin-4-ylanilino)-2H-pyrazolo[3,4-d]pyrimidin-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-cyclopentyl-6-(4-morpholin-4-ylanilino)-2H-pyrazolo[3,4-d]pyrimidin-3-one?
The IUPAC name of 1-cyclopentyl-6-(4-morpholin-4-ylanilino)-2H-pyrazolo[3,4-d]pyrimidin-3-one (CID 59686676) is 1-cyclopentyl-6-(4-morpholin-4-ylanilino)-2H-pyrazolo[3,4-d]pyrimidin-3-one.
What is the SMILES notation for 1-cyclopentyl-6-(4-morpholin-4-ylanilino)-2H-pyrazolo[3,4-d]pyrimidin-3-one?
The canonical SMILES for 1-cyclopentyl-6-(4-morpholin-4-ylanilino)-2H-pyrazolo[3,4-d]pyrimidin-3-one is O=c1[nH]n(C2CCCC2)c2nc(Nc3ccc(N4CCOCC4)cc3)ncc12.
What is the InChIKey of 1-cyclopentyl-6-(4-morpholin-4-ylanilino)-2H-pyrazolo[3,4-d]pyrimidin-3-one?
The InChIKey is NESBVBBVKUDXFD-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H24N6O2/c27-19-17-13-21-20(23-18(17)26(24-19)16-3-1-2-4-16)22-14-5-7-15(8-6-14)25-9-11-28-12-10-25/h5-8,13,16H,1-4,9-12H2,(H,24,27)(H,21,22,23).
What are the key properties of 1-cyclopentyl-6-(4-morpholin-4-ylanilino)-2H-pyrazolo[3,4-d]pyrimidin-3-one?
1-cyclopentyl-6-(4-morpholin-4-ylanilino)-2H-pyrazolo[3,4-d]pyrimidin-3-one has a molecular weight of 380.45 g/mol, XLogP of 2.81, 4 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 1-cyclopentyl-6-(4-morpholin-4-ylanilino)-2H-pyrazolo[3,4-d]pyrimidin-3-one is sourced from PubChem (CID 59686676), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).