C22H26ClFN6O — CID 134135542
8-cyclopentyl-6-fluoro-2-(4-piperazin-1-ylanilino)pyrido[2,3-d]pyrimidin-7-one;hydrochloride (PubChem CID 134135542) has the molecular formula C22H26ClFN6O and a molecular weight of 444.94 g/mol. Its IUPAC name is 8-cyclopentyl-6-fluoro-2-(4-piperazin-1-ylanilino)pyrido[2,3-d]pyrimidin-7-one;hydrochloride.
| Compound Name | 8-cyclopentyl-6-fluoro-2-(4-piperazin-1-ylanilino)pyrido[2,3-d]pyrimidin-7-one;hydrochloride |
|---|---|
| PubChem CID | 134135542 |
| Molecular Formula | C22H26ClFN6O |
| Molecular Weight | 444.94 g/mol |
| Exact Mass | 444.18 |
| IUPAC Name | 8-cyclopentyl-6-fluoro-2-(4-piperazin-1-ylanilino)pyrido[2,3-d]pyrimidin-7-one;hydrochloride |
| SMILES | Cl.O=c1c(F)cc2cnc(Nc3ccc(N4CCNCC4)cc3)nc2n1C1CCCC1 |
| InChI | InChI=1S/C22H25FN6O.ClH/c23-19-13-15-14-25-22(27-20(15)29(21(19)30)18-3-1-2-4-18)26-16-5-7-17(8-6-16)28-11-9-24-10-12-28;/h5-8,13-14,18,24H,1-4,9-12H2,(H,25,26,27);1H |
| InChIKey | UUJYPYUBDWYOPJ-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 75.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.94 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|