C25H33N7O — CID 59290955
7-cyclopentyl-N,N,5-trimethyl-2-(4-piperazin-1-ylanilino)pyrrolo[2,3-d]pyrimidine-6-carboxamide (PubChem CID 59290955) has the molecular formula C25H33N7O and a molecular weight of 447.59 g/mol. Its IUPAC name is 7-cyclopentyl-N,N,5-trimethyl-2-(4-piperazin-1-ylanilino)pyrrolo[2,3-d]pyrimidine-6-carboxamide.
| Compound Name | 7-cyclopentyl-N,N,5-trimethyl-2-(4-piperazin-1-ylanilino)pyrrolo[2,3-d]pyrimidine-6-carboxamide |
|---|---|
| PubChem CID | 59290955 |
| Molecular Formula | C25H33N7O |
| Molecular Weight | 447.59 g/mol |
| Exact Mass | 447.27 |
| IUPAC Name | 7-cyclopentyl-N,N,5-trimethyl-2-(4-piperazin-1-ylanilino)pyrrolo[2,3-d]pyrimidine-6-carboxamide |
| SMILES | Cc1c(C(=O)N(C)C)n(C2CCCC2)c2nc(Nc3ccc(N4CCNCC4)cc3)ncc12 |
| InChI | InChI=1S/C25H33N7O/c1-17-21-16-27-25(28-18-8-10-19(11-9-18)31-14-12-26-13-15-31)29-23(21)32(20-6-4-5-7-20)22(17)24(33)30(2)3/h8-11,16,20,26H,4-7,12-15H2,1-3H3,(H,27,28,29) |
| InChIKey | KMPZQIKSJHNAPA-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 78.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.59 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|