C21H27N7 — CID 59686636
1-cyclohexyl-N-(4-piperazin-1-ylphenyl)pyrazolo[3,4-d]pyrimidin-6-amine (PubChem CID 59686636) has the molecular formula C21H27N7 and a molecular weight of 377.50 g/mol. Its IUPAC name is 1-cyclohexyl-N-(4-piperazin-1-ylphenyl)pyrazolo[3,4-d]pyrimidin-6-amine.
| Compound Name | 1-cyclohexyl-N-(4-piperazin-1-ylphenyl)pyrazolo[3,4-d]pyrimidin-6-amine |
|---|---|
| PubChem CID | 59686636 |
| Molecular Formula | C21H27N7 |
| Molecular Weight | 377.50 g/mol |
| Exact Mass | 377.23 |
| IUPAC Name | 1-cyclohexyl-N-(4-piperazin-1-ylphenyl)pyrazolo[3,4-d]pyrimidin-6-amine |
| SMILES | c1cc(N2CCNCC2)ccc1Nc1ncc2cnn(C3CCCCC3)c2n1 |
| InChI | InChI=1S/C21H27N7/c1-2-4-19(5-3-1)28-20-16(15-24-28)14-23-21(26-20)25-17-6-8-18(9-7-17)27-12-10-22-11-13-27/h6-9,14-15,19,22H,1-5,10-13H2,(H,23,25,26) |
| InChIKey | ZEBMZQZNDAYULB-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 70.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.50 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|