C23H25N7O — CID 67003357
1-[(4-methoxyphenyl)methyl]-N-(4-piperazin-1-ylphenyl)pyrazolo[3,4-d]pyrimidin-6-amine (PubChem CID 67003357) has the molecular formula C23H25N7O and a molecular weight of 415.50 g/mol. Its IUPAC name is 1-[(4-methoxyphenyl)methyl]-N-(4-piperazin-1-ylphenyl)pyrazolo[3,4-d]pyrimidin-6-amine.
| Compound Name | 1-[(4-methoxyphenyl)methyl]-N-(4-piperazin-1-ylphenyl)pyrazolo[3,4-d]pyrimidin-6-amine |
|---|---|
| PubChem CID | 67003357 |
| Molecular Formula | C23H25N7O |
| Molecular Weight | 415.50 g/mol |
| Exact Mass | 415.21 |
| IUPAC Name | 1-[(4-methoxyphenyl)methyl]-N-(4-piperazin-1-ylphenyl)pyrazolo[3,4-d]pyrimidin-6-amine |
| SMILES | COc1ccc(Cn2ncc3cnc(Nc4ccc(N5CCNCC5)cc4)nc32)cc1 |
| InChI | InChI=1S/C23H25N7O/c1-31-21-8-2-17(3-9-21)16-30-22-18(15-26-30)14-25-23(28-22)27-19-4-6-20(7-5-19)29-12-10-24-11-13-29/h2-9,14-15,24H,10-13,16H2,1H3,(H,25,27,28) |
| InChIKey | SOMQXJCZKFSGHR-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 80.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.50 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|