C21H26N8O — CID 23648870
5-methoxy-N-(4-piperazin-1-ylphenyl)-4-(3,4,6,7-tetrahydroimidazo[4,5-c]pyridin-5-yl)pyrimidin-2-amine (PubChem CID 23648870) has the molecular formula C21H26N8O and a molecular weight of 406.49 g/mol. Its IUPAC name is 5-methoxy-N-(4-piperazin-1-ylphenyl)-4-(3,4,6,7-tetrahydroimidazo[4,5-c]pyridin-5-yl)pyrimidin-2-amine.
| Compound Name | 5-methoxy-N-(4-piperazin-1-ylphenyl)-4-(3,4,6,7-tetrahydroimidazo[4,5-c]pyridin-5-yl)pyrimidin-2-amine |
|---|---|
| PubChem CID | 23648870 |
| Molecular Formula | C21H26N8O |
| Molecular Weight | 406.49 g/mol |
| Exact Mass | 406.22 |
| IUPAC Name | 5-methoxy-N-(4-piperazin-1-ylphenyl)-4-(3,4,6,7-tetrahydroimidazo[4,5-c]pyridin-5-yl)pyrimidin-2-amine |
| SMILES | COc1cnc(Nc2ccc(N3CCNCC3)cc2)nc1N1CCc2nc[nH]c2C1 |
| InChI | InChI=1S/C21H26N8O/c1-30-19-12-23-21(27-20(19)29-9-6-17-18(13-29)25-14-24-17)26-15-2-4-16(5-3-15)28-10-7-22-8-11-28/h2-5,12,14,22H,6-11,13H2,1H3,(H,24,25)(H,23,26,27) |
| InChIKey | SALKNKTXOPBTPP-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 94.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.49 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|