C23H26N6 — CID 167674771
N-(4-piperazin-1-ylphenyl)-9-propan-2-yl-7H-pyrrolo[3,4-h]quinazolin-2-amine (PubChem CID 167674771) has the molecular formula C23H26N6 and a molecular weight of 386.50 g/mol. Its IUPAC name is N-(4-piperazin-1-ylphenyl)-9-propan-2-yl-7H-pyrrolo[3,4-h]quinazolin-2-amine.
| Compound Name | N-(4-piperazin-1-ylphenyl)-9-propan-2-yl-7H-pyrrolo[3,4-h]quinazolin-2-amine |
|---|---|
| PubChem CID | 167674771 |
| Molecular Formula | C23H26N6 |
| Molecular Weight | 386.50 g/mol |
| Exact Mass | 386.22 |
| IUPAC Name | N-(4-piperazin-1-ylphenyl)-9-propan-2-yl-7H-pyrrolo[3,4-h]quinazolin-2-amine |
| SMILES | CC(C)C1=NCc2ccc3cnc(Nc4ccc(N5CCNCC5)cc4)nc3c21 |
| InChI | InChI=1S/C23H26N6/c1-15(2)21-20-16(13-25-21)3-4-17-14-26-23(28-22(17)20)27-18-5-7-19(8-6-18)29-11-9-24-10-12-29/h3-8,14-15,24H,9-13H2,1-2H3,(H,26,27,28) |
| InChIKey | QDWHARWSIHARTQ-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 65.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.50 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|