C28H24ClFN6 — CID 163635788
9-chloro-7-(2-fluorophenyl)-N-(4-piperazin-1-ylphenyl)-5H-pyrimido[5,4-d][2]benzazepin-2-amine (PubChem CID 163635788) has the molecular formula C28H24ClFN6 and a molecular weight of 498.99 g/mol. Its IUPAC name is 9-chloro-7-(2-fluorophenyl)-N-(4-piperazin-1-ylphenyl)-5H-pyrimido[5,4-d][2]benzazepin-2-amine.
| Compound Name | 9-chloro-7-(2-fluorophenyl)-N-(4-piperazin-1-ylphenyl)-5H-pyrimido[5,4-d][2]benzazepin-2-amine |
|---|---|
| PubChem CID | 163635788 |
| Molecular Formula | C28H24ClFN6 |
| Molecular Weight | 498.99 g/mol |
| Exact Mass | 498.17 |
| IUPAC Name | 9-chloro-7-(2-fluorophenyl)-N-(4-piperazin-1-ylphenyl)-5H-pyrimido[5,4-d][2]benzazepin-2-amine |
| SMILES | Fc1ccccc1C1=NCc2cnc(Nc3ccc(N4CCNCC4)cc3)nc2-c2ccc(Cl)cc21 |
| InChI | InChI=1S/C28H24ClFN6/c29-19-5-10-22-24(15-19)27(23-3-1-2-4-25(23)30)32-16-18-17-33-28(35-26(18)22)34-20-6-8-21(9-7-20)36-13-11-31-12-14-36/h1-10,15,17,31H,11-14,16H2,(H,33,34,35) |
| InChIKey | HZZSCKOFIFYBEY-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 65.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.99 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|