C19H24N6O2 — CID 138530946
7-(4-piperazin-1-ylanilino)-3-propan-2-yl-2H-pyrimido[5,4-e][1,3]oxazin-4-one (PubChem CID 138530946) has the molecular formula C19H24N6O2 and a molecular weight of 368.44 g/mol. Its IUPAC name is 7-(4-piperazin-1-ylanilino)-3-propan-2-yl-2H-pyrimido[5,4-e][1,3]oxazin-4-one.
| Compound Name | 7-(4-piperazin-1-ylanilino)-3-propan-2-yl-2H-pyrimido[5,4-e][1,3]oxazin-4-one |
|---|---|
| PubChem CID | 138530946 |
| Molecular Formula | C19H24N6O2 |
| Molecular Weight | 368.44 g/mol |
| Exact Mass | 368.20 |
| IUPAC Name | 7-(4-piperazin-1-ylanilino)-3-propan-2-yl-2H-pyrimido[5,4-e][1,3]oxazin-4-one |
| SMILES | CC(C)N1COc2nc(Nc3ccc(N4CCNCC4)cc3)ncc2C1=O |
| InChI | InChI=1S/C19H24N6O2/c1-13(2)25-12-27-17-16(18(25)26)11-21-19(23-17)22-14-3-5-15(6-4-14)24-9-7-20-8-10-24/h3-6,11,13,20H,7-10,12H2,1-2H3,(H,21,22,23) |
| InChIKey | ITETVQBBYQKZLE-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 82.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.44 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|