C24H24Cl2N6O2 — CID 138521486
3-(2,6-dichlorophenyl)-7-(3,5-dimethyl-4-piperazin-1-ylanilino)-2H-pyrimido[5,4-e][1,3]oxazin-4-one (PubChem CID 138521486) has the molecular formula C24H24Cl2N6O2 and a molecular weight of 499.40 g/mol. Its IUPAC name is 3-(2,6-dichlorophenyl)-7-(3,5-dimethyl-4-piperazin-1-ylanilino)-2H-pyrimido[5,4-e][1,3]oxazin-4-one.
| Compound Name | 3-(2,6-dichlorophenyl)-7-(3,5-dimethyl-4-piperazin-1-ylanilino)-2H-pyrimido[5,4-e][1,3]oxazin-4-one |
|---|---|
| PubChem CID | 138521486 |
| Molecular Formula | C24H24Cl2N6O2 |
| Molecular Weight | 499.40 g/mol |
| Exact Mass | 498.13 |
| IUPAC Name | 3-(2,6-dichlorophenyl)-7-(3,5-dimethyl-4-piperazin-1-ylanilino)-2H-pyrimido[5,4-e][1,3]oxazin-4-one |
| SMILES | Cc1cc(Nc2ncc3c(n2)OCN(c2c(Cl)cccc2Cl)C3=O)cc(C)c1N1CCNCC1 |
| InChI | InChI=1S/C24H24Cl2N6O2/c1-14-10-16(11-15(2)20(14)31-8-6-27-7-9-31)29-24-28-12-17-22(30-24)34-13-32(23(17)33)21-18(25)4-3-5-19(21)26/h3-5,10-12,27H,6-9,13H2,1-2H3,(H,28,29,30) |
| InChIKey | GSBHTLDCLDQEBD-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 82.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.40 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|