C24H24Cl2N6O3 — CID 155205474
3-(2,6-dichlorophenyl)-7-[3-(methylaminomethyl)-4-morpholin-4-ylanilino]-2H-pyrimido[5,4-e][1,3]oxazin-4-one (PubChem CID 155205474) has the molecular formula C24H24Cl2N6O3 and a molecular weight of 515.40 g/mol. Its IUPAC name is 3-(2,6-dichlorophenyl)-7-[3-(methylaminomethyl)-4-morpholin-4-ylanilino]-2H-pyrimido[5,4-e][1,3]oxazin-4-one.
| Compound Name | 3-(2,6-dichlorophenyl)-7-[3-(methylaminomethyl)-4-morpholin-4-ylanilino]-2H-pyrimido[5,4-e][1,3]oxazin-4-one |
|---|---|
| PubChem CID | 155205474 |
| Molecular Formula | C24H24Cl2N6O3 |
| Molecular Weight | 515.40 g/mol |
| Exact Mass | 514.13 |
| IUPAC Name | 3-(2,6-dichlorophenyl)-7-[3-(methylaminomethyl)-4-morpholin-4-ylanilino]-2H-pyrimido[5,4-e][1,3]oxazin-4-one |
| SMILES | CNCc1cc(Nc2ncc3c(n2)OCN(c2c(Cl)cccc2Cl)C3=O)ccc1N1CCOCC1 |
| InChI | InChI=1S/C24H24Cl2N6O3/c1-27-12-15-11-16(5-6-20(15)31-7-9-34-10-8-31)29-24-28-13-17-22(30-24)35-14-32(23(17)33)21-18(25)3-2-4-19(21)26/h2-6,11,13,27H,7-10,12,14H2,1H3,(H,28,29,30) |
| InChIKey | DMGAMVIVQBELBX-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 91.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.40 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|