C25H22Cl3F3N6O2 — CID 138531036
7-[3-chloro-4-[4-(3,3,3-trifluoropropyl)piperazin-1-yl]anilino]-3-(2,6-dichlorophenyl)-2H-pyrimido[5,4-e][1,3]oxazin-4-one (PubChem CID 138531036) has the molecular formula C25H22Cl3F3N6O2 and a molecular weight of 601.84 g/mol. Its IUPAC name is 7-[3-chloro-4-[4-(3,3,3-trifluoropropyl)piperazin-1-yl]anilino]-3-(2,6-dichlorophenyl)-2H-pyrimido[5,4-e][1,3]oxazin-4-one.
| Compound Name | 7-[3-chloro-4-[4-(3,3,3-trifluoropropyl)piperazin-1-yl]anilino]-3-(2,6-dichlorophenyl)-2H-pyrimido[5,4-e][1,3]oxazin-4-one |
|---|---|
| PubChem CID | 138531036 |
| Molecular Formula | C25H22Cl3F3N6O2 |
| Molecular Weight | 601.84 g/mol |
| Exact Mass | 600.08 |
| IUPAC Name | 7-[3-chloro-4-[4-(3,3,3-trifluoropropyl)piperazin-1-yl]anilino]-3-(2,6-dichlorophenyl)-2H-pyrimido[5,4-e][1,3]oxazin-4-one |
| SMILES | O=C1c2cnc(Nc3ccc(N4CCN(CCC(F)(F)F)CC4)c(Cl)c3)nc2OCN1c1c(Cl)cccc1Cl |
| InChI | InChI=1S/C25H22Cl3F3N6O2/c26-17-2-1-3-18(27)21(17)37-14-39-22-16(23(37)38)13-32-24(34-22)33-15-4-5-20(19(28)12-15)36-10-8-35(9-11-36)7-6-25(29,30)31/h1-5,12-13H,6-11,14H2,(H,32,33,34) |
| InChIKey | WGNBFRCQANJVEM-UHFFFAOYSA-N |
| XLogP | 6.25 |
| TPSA | 73.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 601.84 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|