C23H21Cl2N5O3 — CID 138521527
3-(2,6-dichlorophenyl)-7-[4-(4-hydroxypiperidin-1-yl)anilino]-2H-pyrimido[5,4-e][1,3]oxazin-4-one (PubChem CID 138521527) has the molecular formula C23H21Cl2N5O3 and a molecular weight of 486.36 g/mol. Its IUPAC name is 3-(2,6-dichlorophenyl)-7-[4-(4-hydroxypiperidin-1-yl)anilino]-2H-pyrimido[5,4-e][1,3]oxazin-4-one.
| Compound Name | 3-(2,6-dichlorophenyl)-7-[4-(4-hydroxypiperidin-1-yl)anilino]-2H-pyrimido[5,4-e][1,3]oxazin-4-one |
|---|---|
| PubChem CID | 138521527 |
| Molecular Formula | C23H21Cl2N5O3 |
| Molecular Weight | 486.36 g/mol |
| Exact Mass | 485.10 |
| IUPAC Name | 3-(2,6-dichlorophenyl)-7-[4-(4-hydroxypiperidin-1-yl)anilino]-2H-pyrimido[5,4-e][1,3]oxazin-4-one |
| SMILES | O=C1c2cnc(Nc3ccc(N4CCC(O)CC4)cc3)nc2OCN1c1c(Cl)cccc1Cl |
| InChI | InChI=1S/C23H21Cl2N5O3/c24-18-2-1-3-19(25)20(18)30-13-33-21-17(22(30)32)12-26-23(28-21)27-14-4-6-15(7-5-14)29-10-8-16(31)9-11-29/h1-7,12,16,31H,8-11,13H2,(H,26,27,28) |
| InChIKey | ZXEQUVGLYITQDK-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 90.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.36 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|