C23H22ClFN6O2 — CID 138521456
3-(2-chloro-6-fluorophenyl)-7-[4-(4-methylpiperazin-1-yl)anilino]-2H-pyrimido[5,4-e][1,3]oxazin-4-one (PubChem CID 138521456) has the molecular formula C23H22ClFN6O2 and a molecular weight of 468.92 g/mol. Its IUPAC name is 3-(2-chloro-6-fluorophenyl)-7-[4-(4-methylpiperazin-1-yl)anilino]-2H-pyrimido[5,4-e][1,3]oxazin-4-one.
| Compound Name | 3-(2-chloro-6-fluorophenyl)-7-[4-(4-methylpiperazin-1-yl)anilino]-2H-pyrimido[5,4-e][1,3]oxazin-4-one |
|---|---|
| PubChem CID | 138521456 |
| Molecular Formula | C23H22ClFN6O2 |
| Molecular Weight | 468.92 g/mol |
| Exact Mass | 468.15 |
| IUPAC Name | 3-(2-chloro-6-fluorophenyl)-7-[4-(4-methylpiperazin-1-yl)anilino]-2H-pyrimido[5,4-e][1,3]oxazin-4-one |
| SMILES | CN1CCN(c2ccc(Nc3ncc4c(n3)OCN(c3c(F)cccc3Cl)C4=O)cc2)CC1 |
| InChI | InChI=1S/C23H22ClFN6O2/c1-29-9-11-30(12-10-29)16-7-5-15(6-8-16)27-23-26-13-17-21(28-23)33-14-31(22(17)32)20-18(24)3-2-4-19(20)25/h2-8,13H,9-12,14H2,1H3,(H,26,27,28) |
| InChIKey | IMFGLYCVLOPSHI-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 73.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.92 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|