C24H23ClFN7O — CID 71224160
6-(2-chloro-6-fluorophenyl)-8-methyl-2-[4-(4-methylpiperazin-1-yl)anilino]pyrimido[4,5-d]pyridazin-5-one (PubChem CID 71224160) has the molecular formula C24H23ClFN7O and a molecular weight of 479.95 g/mol. Its IUPAC name is 6-(2-chloro-6-fluorophenyl)-8-methyl-2-[4-(4-methylpiperazin-1-yl)anilino]pyrimido[4,5-d]pyridazin-5-one.
| Compound Name | 6-(2-chloro-6-fluorophenyl)-8-methyl-2-[4-(4-methylpiperazin-1-yl)anilino]pyrimido[4,5-d]pyridazin-5-one |
|---|---|
| PubChem CID | 71224160 |
| Molecular Formula | C24H23ClFN7O |
| Molecular Weight | 479.95 g/mol |
| Exact Mass | 479.16 |
| IUPAC Name | 6-(2-chloro-6-fluorophenyl)-8-methyl-2-[4-(4-methylpiperazin-1-yl)anilino]pyrimido[4,5-d]pyridazin-5-one |
| SMILES | Cc1nn(-c2c(F)cccc2Cl)c(=O)c2cnc(Nc3ccc(N4CCN(C)CC4)cc3)nc12 |
| InChI | InChI=1S/C24H23ClFN7O/c1-15-21-18(23(34)33(30-15)22-19(25)4-3-5-20(22)26)14-27-24(29-21)28-16-6-8-17(9-7-16)32-12-10-31(2)11-13-32/h3-9,14H,10-13H2,1-2H3,(H,27,28,29) |
| InChIKey | MLRDHMPPQSXDHA-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 79.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.95 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|