C28H24Cl2N8O3S — CID 71224326
6-(2,6-dichlorophenyl)-2-[4-(4-methylsulfonylpiperazin-1-yl)anilino]-8-pyridin-2-ylpyrimido[4,5-d]pyridazin-5-one (PubChem CID 71224326) has the molecular formula C28H24Cl2N8O3S and a molecular weight of 623.53 g/mol. Its IUPAC name is 6-(2,6-dichlorophenyl)-2-[4-(4-methylsulfonylpiperazin-1-yl)anilino]-8-pyridin-2-ylpyrimido[4,5-d]pyridazin-5-one.
| Compound Name | 6-(2,6-dichlorophenyl)-2-[4-(4-methylsulfonylpiperazin-1-yl)anilino]-8-pyridin-2-ylpyrimido[4,5-d]pyridazin-5-one |
|---|---|
| PubChem CID | 71224326 |
| Molecular Formula | C28H24Cl2N8O3S |
| Molecular Weight | 623.53 g/mol |
| Exact Mass | 622.11 |
| IUPAC Name | 6-(2,6-dichlorophenyl)-2-[4-(4-methylsulfonylpiperazin-1-yl)anilino]-8-pyridin-2-ylpyrimido[4,5-d]pyridazin-5-one |
| SMILES | CS(=O)(=O)N1CCN(c2ccc(Nc3ncc4c(=O)n(-c5c(Cl)cccc5Cl)nc(-c5ccccn5)c4n3)cc2)CC1 |
| InChI | InChI=1S/C28H24Cl2N8O3S/c1-42(40,41)37-15-13-36(14-16-37)19-10-8-18(9-11-19)33-28-32-17-20-24(34-28)25(23-7-2-3-12-31-23)35-38(27(20)39)26-21(29)5-4-6-22(26)30/h2-12,17H,13-16H2,1H3,(H,32,33,34) |
| InChIKey | IAEHONJSYIPLJY-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 126.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 623.53 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|