C28H28N10O3S — CID 170282962
6-[4-(4-methylsulfonylpiperazin-1-yl)anilino]-2-prop-2-enyl-1-(6-pyrazin-2-yl-2-pyridinyl)pyrazolo[3,4-d]pyrimidin-3-one (PubChem CID 170282962) has the molecular formula C28H28N10O3S and a molecular weight of 584.67 g/mol. Its IUPAC name is 6-[4-(4-methylsulfonylpiperazin-1-yl)anilino]-2-prop-2-enyl-1-(6-pyrazin-2-yl-2-pyridinyl)pyrazolo[3,4-d]pyrimidin-3-one.
| Compound Name | 6-[4-(4-methylsulfonylpiperazin-1-yl)anilino]-2-prop-2-enyl-1-(6-pyrazin-2-yl-2-pyridinyl)pyrazolo[3,4-d]pyrimidin-3-one |
|---|---|
| PubChem CID | 170282962 |
| Molecular Formula | C28H28N10O3S |
| Molecular Weight | 584.67 g/mol |
| Exact Mass | 584.21 |
| IUPAC Name | 6-[4-(4-methylsulfonylpiperazin-1-yl)anilino]-2-prop-2-enyl-1-(6-pyrazin-2-yl-2-pyridinyl)pyrazolo[3,4-d]pyrimidin-3-one |
| SMILES | C=CCn1c(=O)c2cnc(Nc3ccc(N4CCN(S(C)(=O)=O)CC4)cc3)nc2n1-c1cccc(-c2cnccn2)n1 |
| InChI | InChI=1S/C28H28N10O3S/c1-3-13-37-27(39)22-18-31-28(32-20-7-9-21(10-8-20)35-14-16-36(17-15-35)42(2,40)41)34-26(22)38(37)25-6-4-5-23(33-25)24-19-29-11-12-30-24/h3-12,18-19H,1,13-17H2,2H3,(H,31,32,34) |
| InChIKey | WECOETYPIVTLIS-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 144.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.67 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|