C30H38N8O2 — CID 67171722
1-[6-(2-hydroxy-2-methylpropyl)-2-pyridinyl]-6-[4-(4-propan-2-ylpiperazin-1-yl)anilino]-2-prop-2-enylpyrazolo[3,4-d]pyrimidin-3-one (PubChem CID 67171722) has the molecular formula C30H38N8O2 and a molecular weight of 542.69 g/mol. Its IUPAC name is 1-[6-(2-hydroxy-2-methylpropyl)-2-pyridinyl]-6-[4-(4-propan-2-ylpiperazin-1-yl)anilino]-2-prop-2-enylpyrazolo[3,4-d]pyrimidin-3-one.
| Compound Name | 1-[6-(2-hydroxy-2-methylpropyl)-2-pyridinyl]-6-[4-(4-propan-2-ylpiperazin-1-yl)anilino]-2-prop-2-enylpyrazolo[3,4-d]pyrimidin-3-one |
|---|---|
| PubChem CID | 67171722 |
| Molecular Formula | C30H38N8O2 |
| Molecular Weight | 542.69 g/mol |
| Exact Mass | 542.31 |
| IUPAC Name | 1-[6-(2-hydroxy-2-methylpropyl)-2-pyridinyl]-6-[4-(4-propan-2-ylpiperazin-1-yl)anilino]-2-prop-2-enylpyrazolo[3,4-d]pyrimidin-3-one |
| SMILES | C=CCn1c(=O)c2cnc(Nc3ccc(N4CCN(C(C)C)CC4)cc3)nc2n1-c1cccc(CC(C)(C)O)n1 |
| InChI | InChI=1S/C30H38N8O2/c1-6-14-37-28(39)25-20-31-29(34-27(25)38(37)26-9-7-8-23(32-26)19-30(4,5)40)33-22-10-12-24(13-11-22)36-17-15-35(16-18-36)21(2)3/h6-13,20-21,40H,1,14-19H2,2-5H3,(H,31,33,34) |
| InChIKey | HKZSHVSAPLZGHT-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 104.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.69 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|