C28H29F3N8O3 — CID 87295186
1-[6-(2-hydroxypropan-2-yl)-2-pyridinyl]-2-prop-2-enyl-6-[4-[4-(2,2,2-trifluoroacetyl)piperazin-1-yl]anilino]pyrazolo[3,4-d]pyrimidin-3-one (PubChem CID 87295186) has the molecular formula C28H29F3N8O3 and a molecular weight of 582.59 g/mol. Its IUPAC name is 1-[6-(2-hydroxypropan-2-yl)-2-pyridinyl]-2-prop-2-enyl-6-[4-[4-(2,2,2-trifluoroacetyl)piperazin-1-yl]anilino]pyrazolo[3,4-d]pyrimidin-3-one.
| Compound Name | 1-[6-(2-hydroxypropan-2-yl)-2-pyridinyl]-2-prop-2-enyl-6-[4-[4-(2,2,2-trifluoroacetyl)piperazin-1-yl]anilino]pyrazolo[3,4-d]pyrimidin-3-one |
|---|---|
| PubChem CID | 87295186 |
| Molecular Formula | C28H29F3N8O3 |
| Molecular Weight | 582.59 g/mol |
| Exact Mass | 582.23 |
| IUPAC Name | 1-[6-(2-hydroxypropan-2-yl)-2-pyridinyl]-2-prop-2-enyl-6-[4-[4-(2,2,2-trifluoroacetyl)piperazin-1-yl]anilino]pyrazolo[3,4-d]pyrimidin-3-one |
| SMILES | C=CCn1c(=O)c2cnc(Nc3ccc(N4CCN(C(=O)C(F)(F)F)CC4)cc3)nc2n1-c1cccc(C(C)(C)O)n1 |
| InChI | InChI=1S/C28H29F3N8O3/c1-4-12-38-24(40)20-17-32-26(35-23(20)39(38)22-7-5-6-21(34-22)27(2,3)42)33-18-8-10-19(11-9-18)36-13-15-37(16-14-36)25(41)28(29,30)31/h4-11,17,42H,1,12-16H2,2-3H3,(H,32,33,35) |
| InChIKey | LRRUTYBOIPFSHM-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 121.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.59 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|