C34H44N8O5 — CID 169226181
4-[4-[4-[4-[[1-[6-(2-hydroxypropan-2-yl)-2-pyridinyl]-3-oxo-2-prop-2-enylpyrazolo[3,4-d]pyrimidin-6-yl]amino]phenyl]piperazin-1-yl]butoxy]butanoic acid (PubChem CID 169226181) has the molecular formula C34H44N8O5 and a molecular weight of 644.78 g/mol. Its IUPAC name is 4-[4-[4-[4-[[1-[6-(2-hydroxypropan-2-yl)-2-pyridinyl]-3-oxo-2-prop-2-enylpyrazolo[3,4-d]pyrimidin-6-yl]amino]phenyl]piperazin-1-yl]butoxy]butanoic acid.
| Compound Name | 4-[4-[4-[4-[[1-[6-(2-hydroxypropan-2-yl)-2-pyridinyl]-3-oxo-2-prop-2-enylpyrazolo[3,4-d]pyrimidin-6-yl]amino]phenyl]piperazin-1-yl]butoxy]butanoic acid |
|---|---|
| PubChem CID | 169226181 |
| Molecular Formula | C34H44N8O5 |
| Molecular Weight | 644.78 g/mol |
| Exact Mass | 644.34 |
| IUPAC Name | 4-[4-[4-[4-[[1-[6-(2-hydroxypropan-2-yl)-2-pyridinyl]-3-oxo-2-prop-2-enylpyrazolo[3,4-d]pyrimidin-6-yl]amino]phenyl]piperazin-1-yl]butoxy]butanoic acid |
| SMILES | C=CCn1c(=O)c2cnc(Nc3ccc(N4CCN(CCCCOCCCC(=O)O)CC4)cc3)nc2n1-c1cccc(C(C)(C)O)n1 |
| InChI | InChI=1S/C34H44N8O5/c1-4-16-41-32(45)27-24-35-33(38-31(27)42(41)29-10-7-9-28(37-29)34(2,3)46)36-25-12-14-26(15-13-25)40-20-18-39(19-21-40)17-5-6-22-47-23-8-11-30(43)44/h4,7,9-10,12-15,24,46H,1,5-6,8,11,16-23H2,2-3H3,(H,43,44)(H,35,36,38) |
| InChIKey | DNBTUBKZFQFXEM-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 150.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 644.78 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|