C35H46N8O6 — CID 169226199
tert-butyl 2-[2-[4-[4-[[1-[6-(2-hydroxypropan-2-yl)-2-pyridinyl]-3-oxo-2-prop-2-enylpyrazolo[3,4-d]pyrimidin-6-yl]amino]phenyl]piperazin-1-yl]ethoxymethoxy]acetate (PubChem CID 169226199) has the molecular formula C35H46N8O6 and a molecular weight of 674.80 g/mol. Its IUPAC name is tert-butyl 2-[2-[4-[4-[[1-[6-(2-hydroxypropan-2-yl)-2-pyridinyl]-3-oxo-2-prop-2-enylpyrazolo[3,4-d]pyrimidin-6-yl]amino]phenyl]piperazin-1-yl]ethoxymethoxy]acetate.
| Compound Name | tert-butyl 2-[2-[4-[4-[[1-[6-(2-hydroxypropan-2-yl)-2-pyridinyl]-3-oxo-2-prop-2-enylpyrazolo[3,4-d]pyrimidin-6-yl]amino]phenyl]piperazin-1-yl]ethoxymethoxy]acetate |
|---|---|
| PubChem CID | 169226199 |
| Molecular Formula | C35H46N8O6 |
| Molecular Weight | 674.80 g/mol |
| Exact Mass | 674.35 |
| IUPAC Name | tert-butyl 2-[2-[4-[4-[[1-[6-(2-hydroxypropan-2-yl)-2-pyridinyl]-3-oxo-2-prop-2-enylpyrazolo[3,4-d]pyrimidin-6-yl]amino]phenyl]piperazin-1-yl]ethoxymethoxy]acetate |
| SMILES | C=CCn1c(=O)c2cnc(Nc3ccc(N4CCN(CCOCOCC(=O)OC(C)(C)C)CC4)cc3)nc2n1-c1cccc(C(C)(C)O)n1 |
| InChI | InChI=1S/C35H46N8O6/c1-7-15-42-32(45)27-22-36-33(39-31(27)43(42)29-10-8-9-28(38-29)35(5,6)46)37-25-11-13-26(14-12-25)41-18-16-40(17-19-41)20-21-47-24-48-23-30(44)49-34(2,3)4/h7-14,22,46H,1,15-21,23-24H2,2-6H3,(H,36,37,39) |
| InChIKey | VVAUUMVDMCQGLV-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 149.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 674.80 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|