C36H48N10O2 — CID 169226213
1-[6-(2-hydroxypropan-2-yl)-2-pyridinyl]-6-[4-[4-(1-piperidin-4-ylpiperidin-4-yl)piperazin-1-yl]anilino]-2-prop-2-enylpyrazolo[3,4-d]pyrimidin-3-one (PubChem CID 169226213) has the molecular formula C36H48N10O2 and a molecular weight of 652.85 g/mol. Its IUPAC name is 1-[6-(2-hydroxypropan-2-yl)-2-pyridinyl]-6-[4-[4-(1-piperidin-4-ylpiperidin-4-yl)piperazin-1-yl]anilino]-2-prop-2-enylpyrazolo[3,4-d]pyrimidin-3-one.
| Compound Name | 1-[6-(2-hydroxypropan-2-yl)-2-pyridinyl]-6-[4-[4-(1-piperidin-4-ylpiperidin-4-yl)piperazin-1-yl]anilino]-2-prop-2-enylpyrazolo[3,4-d]pyrimidin-3-one |
|---|---|
| PubChem CID | 169226213 |
| Molecular Formula | C36H48N10O2 |
| Molecular Weight | 652.85 g/mol |
| Exact Mass | 652.40 |
| IUPAC Name | 1-[6-(2-hydroxypropan-2-yl)-2-pyridinyl]-6-[4-[4-(1-piperidin-4-ylpiperidin-4-yl)piperazin-1-yl]anilino]-2-prop-2-enylpyrazolo[3,4-d]pyrimidin-3-one |
| SMILES | C=CCn1c(=O)c2cnc(Nc3ccc(N4CCN(C5CCN(C6CCNCC6)CC5)CC4)cc3)nc2n1-c1cccc(C(C)(C)O)n1 |
| InChI | InChI=1S/C36H48N10O2/c1-4-18-45-34(47)30-25-38-35(41-33(30)46(45)32-7-5-6-31(40-32)36(2,3)48)39-26-8-10-27(11-9-26)43-21-23-44(24-22-43)29-14-19-42(20-15-29)28-12-16-37-17-13-28/h4-11,25,28-29,37,48H,1,12-24H2,2-3H3,(H,38,39,41) |
| InChIKey | TYJCRULXDCRUEL-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 119.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 652.85 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|