C31H40N8O3 — CID 67170356
6-[4-[4-(2-ethoxyethyl)piperazin-1-yl]anilino]-1-[6-(1-hydroxy-2-methylpropan-2-yl)-2-pyridinyl]-2-prop-2-enylpyrazolo[3,4-d]pyrimidin-3-one (PubChem CID 67170356) has the molecular formula C31H40N8O3 and a molecular weight of 572.71 g/mol. Its IUPAC name is 6-[4-[4-(2-ethoxyethyl)piperazin-1-yl]anilino]-1-[6-(1-hydroxy-2-methylpropan-2-yl)-2-pyridinyl]-2-prop-2-enylpyrazolo[3,4-d]pyrimidin-3-one.
| Compound Name | 6-[4-[4-(2-ethoxyethyl)piperazin-1-yl]anilino]-1-[6-(1-hydroxy-2-methylpropan-2-yl)-2-pyridinyl]-2-prop-2-enylpyrazolo[3,4-d]pyrimidin-3-one |
|---|---|
| PubChem CID | 67170356 |
| Molecular Formula | C31H40N8O3 |
| Molecular Weight | 572.71 g/mol |
| Exact Mass | 572.32 |
| IUPAC Name | 6-[4-[4-(2-ethoxyethyl)piperazin-1-yl]anilino]-1-[6-(1-hydroxy-2-methylpropan-2-yl)-2-pyridinyl]-2-prop-2-enylpyrazolo[3,4-d]pyrimidin-3-one |
| SMILES | C=CCn1c(=O)c2cnc(Nc3ccc(N4CCN(CCOCC)CC4)cc3)nc2n1-c1cccc(C(C)(C)CO)n1 |
| InChI | InChI=1S/C31H40N8O3/c1-5-14-38-29(41)25-21-32-30(35-28(25)39(38)27-9-7-8-26(34-27)31(3,4)22-40)33-23-10-12-24(13-11-23)37-17-15-36(16-18-37)19-20-42-6-2/h5,7-13,21,40H,1,6,14-20,22H2,2-4H3,(H,32,33,35) |
| InChIKey | GKGYVKNEEBLBPL-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 113.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.71 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|