C34H41F3N8O3 — CID 162774650
6-[4-[4-(9-methoxynonanoyl)piperazin-1-yl]anilino]-2-prop-2-enyl-1-[6-(trifluoromethyl)-2-pyridinyl]pyrazolo[3,4-d]pyrimidin-3-one (PubChem CID 162774650) has the molecular formula C34H41F3N8O3 and a molecular weight of 666.75 g/mol. Its IUPAC name is 6-[4-[4-(9-methoxynonanoyl)piperazin-1-yl]anilino]-2-prop-2-enyl-1-[6-(trifluoromethyl)-2-pyridinyl]pyrazolo[3,4-d]pyrimidin-3-one.
| Compound Name | 6-[4-[4-(9-methoxynonanoyl)piperazin-1-yl]anilino]-2-prop-2-enyl-1-[6-(trifluoromethyl)-2-pyridinyl]pyrazolo[3,4-d]pyrimidin-3-one |
|---|---|
| PubChem CID | 162774650 |
| Molecular Formula | C34H41F3N8O3 |
| Molecular Weight | 666.75 g/mol |
| Exact Mass | 666.33 |
| IUPAC Name | 6-[4-[4-(9-methoxynonanoyl)piperazin-1-yl]anilino]-2-prop-2-enyl-1-[6-(trifluoromethyl)-2-pyridinyl]pyrazolo[3,4-d]pyrimidin-3-one |
| SMILES | C=CCn1c(=O)c2cnc(Nc3ccc(N4CCN(C(=O)CCCCCCCCOC)CC4)cc3)nc2n1-c1cccc(C(F)(F)F)n1 |
| InChI | InChI=1S/C34H41F3N8O3/c1-3-18-44-32(47)27-24-38-33(41-31(27)45(44)29-12-10-11-28(40-29)34(35,36)37)39-25-14-16-26(17-15-25)42-19-21-43(22-20-42)30(46)13-8-6-4-5-7-9-23-48-2/h3,10-12,14-17,24H,1,4-9,13,18-23H2,2H3,(H,38,39,41) |
| InChIKey | WOTBFVDPOVFUQU-UHFFFAOYSA-N |
| XLogP | 5.95 |
| TPSA | 110.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 666.75 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|