C28H25ClN8O — CID 71223947
6-(2-chlorophenyl)-2-[4-(4-methylpiperazin-1-yl)anilino]-8-pyridin-4-ylpyrimido[4,5-d]pyridazin-5-one (PubChem CID 71223947) has the molecular formula C28H25ClN8O and a molecular weight of 525.02 g/mol. Its IUPAC name is 6-(2-chlorophenyl)-2-[4-(4-methylpiperazin-1-yl)anilino]-8-pyridin-4-ylpyrimido[4,5-d]pyridazin-5-one.
| Compound Name | 6-(2-chlorophenyl)-2-[4-(4-methylpiperazin-1-yl)anilino]-8-pyridin-4-ylpyrimido[4,5-d]pyridazin-5-one |
|---|---|
| PubChem CID | 71223947 |
| Molecular Formula | C28H25ClN8O |
| Molecular Weight | 525.02 g/mol |
| Exact Mass | 524.18 |
| IUPAC Name | 6-(2-chlorophenyl)-2-[4-(4-methylpiperazin-1-yl)anilino]-8-pyridin-4-ylpyrimido[4,5-d]pyridazin-5-one |
| SMILES | CN1CCN(c2ccc(Nc3ncc4c(=O)n(-c5ccccc5Cl)nc(-c5ccncc5)c4n3)cc2)CC1 |
| InChI | InChI=1S/C28H25ClN8O/c1-35-14-16-36(17-15-35)21-8-6-20(7-9-21)32-28-31-18-22-26(33-28)25(19-10-12-30-13-11-19)34-37(27(22)38)24-5-3-2-4-23(24)29/h2-13,18H,14-17H2,1H3,(H,31,32,33) |
| InChIKey | OKICXIKIJWNZSA-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 92.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.02 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|