C25H25ClN6O2 — CID 169085677
7-(2-chloro-6-methoxyphenyl)-2-[4-(4-methylpiperazin-1-yl)anilino]pyrido[3,4-d]pyrimidin-8-one (PubChem CID 169085677) has the molecular formula C25H25ClN6O2 and a molecular weight of 476.97 g/mol. Its IUPAC name is 7-(2-chloro-6-methoxyphenyl)-2-[4-(4-methylpiperazin-1-yl)anilino]pyrido[3,4-d]pyrimidin-8-one.
| Compound Name | 7-(2-chloro-6-methoxyphenyl)-2-[4-(4-methylpiperazin-1-yl)anilino]pyrido[3,4-d]pyrimidin-8-one |
|---|---|
| PubChem CID | 169085677 |
| Molecular Formula | C25H25ClN6O2 |
| Molecular Weight | 476.97 g/mol |
| Exact Mass | 476.17 |
| IUPAC Name | 7-(2-chloro-6-methoxyphenyl)-2-[4-(4-methylpiperazin-1-yl)anilino]pyrido[3,4-d]pyrimidin-8-one |
| SMILES | COc1cccc(Cl)c1-n1ccc2cnc(Nc3ccc(N4CCN(C)CC4)cc3)nc2c1=O |
| InChI | InChI=1S/C25H25ClN6O2/c1-30-12-14-31(15-13-30)19-8-6-18(7-9-19)28-25-27-16-17-10-11-32(24(33)22(17)29-25)23-20(26)4-3-5-21(23)34-2/h3-11,16H,12-15H2,1-2H3,(H,27,28,29) |
| InChIKey | IOSZAAWEBUBAIQ-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 75.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.97 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|