C27H34N6O2 — CID 169158157
N-[4-[2-[4-(4-methylpiperazin-1-yl)anilino]quinazolin-8-yl]oxycyclohexyl]acetamide (PubChem CID 169158157) has the molecular formula C27H34N6O2 and a molecular weight of 474.61 g/mol. Its IUPAC name is N-[4-[2-[4-(4-methylpiperazin-1-yl)anilino]quinazolin-8-yl]oxycyclohexyl]acetamide.
| Compound Name | N-[4-[2-[4-(4-methylpiperazin-1-yl)anilino]quinazolin-8-yl]oxycyclohexyl]acetamide |
|---|---|
| PubChem CID | 169158157 |
| Molecular Formula | C27H34N6O2 |
| Molecular Weight | 474.61 g/mol |
| Exact Mass | 474.27 |
| IUPAC Name | N-[4-[2-[4-(4-methylpiperazin-1-yl)anilino]quinazolin-8-yl]oxycyclohexyl]acetamide |
| SMILES | CC(=O)NC1CCC(Oc2cccc3cnc(Nc4ccc(N5CCN(C)CC5)cc4)nc23)CC1 |
| InChI | InChI=1S/C27H34N6O2/c1-19(34)29-21-8-12-24(13-9-21)35-25-5-3-4-20-18-28-27(31-26(20)25)30-22-6-10-23(11-7-22)33-16-14-32(2)15-17-33/h3-7,10-11,18,21,24H,8-9,12-17H2,1-2H3,(H,29,34)(H,28,30,31) |
| InChIKey | VMCQIVFCMXXACP-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 82.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.61 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|