C29H37N7O — CID 169088908
4-(cyclopentylamino)-N-(2,6-dimethylphenyl)-2-[4-(4-methylpiperazin-1-yl)anilino]pyrimidine-5-carboxamide (PubChem CID 169088908) has the molecular formula C29H37N7O and a molecular weight of 499.66 g/mol. Its IUPAC name is 4-(cyclopentylamino)-N-(2,6-dimethylphenyl)-2-[4-(4-methylpiperazin-1-yl)anilino]pyrimidine-5-carboxamide.
| Compound Name | 4-(cyclopentylamino)-N-(2,6-dimethylphenyl)-2-[4-(4-methylpiperazin-1-yl)anilino]pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 169088908 |
| Molecular Formula | C29H37N7O |
| Molecular Weight | 499.66 g/mol |
| Exact Mass | 499.31 |
| IUPAC Name | 4-(cyclopentylamino)-N-(2,6-dimethylphenyl)-2-[4-(4-methylpiperazin-1-yl)anilino]pyrimidine-5-carboxamide |
| SMILES | Cc1cccc(C)c1NC(=O)c1cnc(Nc2ccc(N3CCN(C)CC3)cc2)nc1NC1CCCC1 |
| InChI | InChI=1S/C29H37N7O/c1-20-7-6-8-21(2)26(20)33-28(37)25-19-30-29(34-27(25)31-22-9-4-5-10-22)32-23-11-13-24(14-12-23)36-17-15-35(3)16-18-36/h6-8,11-14,19,22H,4-5,9-10,15-18H2,1-3H3,(H,33,37)(H2,30,31,32,34) |
| InChIKey | BLQCAGWUWSASNH-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 85.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.66 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|