C31H33ClN8O3S — CID 155432590
N-(2-chloro-6-methylphenyl)-4-[2-(ethenylsulfonylamino)anilino]-2-[4-(4-methylpiperazin-1-yl)anilino]pyrimidine-5-carboxamide (PubChem CID 155432590) has the molecular formula C31H33ClN8O3S and a molecular weight of 633.18 g/mol. Its IUPAC name is N-(2-chloro-6-methylphenyl)-4-[2-(ethenylsulfonylamino)anilino]-2-[4-(4-methylpiperazin-1-yl)anilino]pyrimidine-5-carboxamide.
| Compound Name | N-(2-chloro-6-methylphenyl)-4-[2-(ethenylsulfonylamino)anilino]-2-[4-(4-methylpiperazin-1-yl)anilino]pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 155432590 |
| Molecular Formula | C31H33ClN8O3S |
| Molecular Weight | 633.18 g/mol |
| Exact Mass | 632.21 |
| IUPAC Name | N-(2-chloro-6-methylphenyl)-4-[2-(ethenylsulfonylamino)anilino]-2-[4-(4-methylpiperazin-1-yl)anilino]pyrimidine-5-carboxamide |
| SMILES | C=CS(=O)(=O)Nc1ccccc1Nc1nc(Nc2ccc(N3CCN(C)CC3)cc2)ncc1C(=O)Nc1c(C)cccc1Cl |
| InChI | InChI=1S/C31H33ClN8O3S/c1-4-44(42,43)38-27-11-6-5-10-26(27)35-29-24(30(41)36-28-21(2)8-7-9-25(28)32)20-33-31(37-29)34-22-12-14-23(15-13-22)40-18-16-39(3)17-19-40/h4-15,20,38H,1,16-19H2,2-3H3,(H,36,41)(H2,33,34,35,37) |
| InChIKey | GYFXWBJQCMGYGF-UHFFFAOYSA-N |
| XLogP | 5.81 |
| TPSA | 131.59 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 633.18 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|