C38H38N8O3 — CID 155415521
2-[4-(4-methylpiperazin-1-yl)anilino]-N-[(4-phenoxyphenyl)methyl]-4-[2-(prop-2-enoylamino)anilino]pyrimidine-5-carboxamide (PubChem CID 155415521) has the molecular formula C38H38N8O3 and a molecular weight of 654.78 g/mol. Its IUPAC name is 2-[4-(4-methylpiperazin-1-yl)anilino]-N-[(4-phenoxyphenyl)methyl]-4-[2-(prop-2-enoylamino)anilino]pyrimidine-5-carboxamide.
| Compound Name | 2-[4-(4-methylpiperazin-1-yl)anilino]-N-[(4-phenoxyphenyl)methyl]-4-[2-(prop-2-enoylamino)anilino]pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 155415521 |
| Molecular Formula | C38H38N8O3 |
| Molecular Weight | 654.78 g/mol |
| Exact Mass | 654.31 |
| IUPAC Name | 2-[4-(4-methylpiperazin-1-yl)anilino]-N-[(4-phenoxyphenyl)methyl]-4-[2-(prop-2-enoylamino)anilino]pyrimidine-5-carboxamide |
| SMILES | C=CC(=O)Nc1ccccc1Nc1nc(Nc2ccc(N3CCN(C)CC3)cc2)ncc1C(=O)NCc1ccc(Oc2ccccc2)cc1 |
| InChI | InChI=1S/C38H38N8O3/c1-3-35(47)42-33-11-7-8-12-34(33)43-36-32(37(48)39-25-27-13-19-31(20-14-27)49-30-9-5-4-6-10-30)26-40-38(44-36)41-28-15-17-29(18-16-28)46-23-21-45(2)22-24-46/h3-20,26H,1,21-25H2,2H3,(H,39,48)(H,42,47)(H2,40,41,43,44) |
| InChIKey | MXZBTUVFBVWXPV-UHFFFAOYSA-N |
| XLogP | 6.56 |
| TPSA | 123.75 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 654.78 |
| LogP ≤ 5 | 6.56 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|