C28H28IN7O2 — CID 70880286
1-benzyl-3-[2-[[5-iodo-2-(4-morpholin-4-ylanilino)pyrimidin-4-yl]amino]phenyl]urea (PubChem CID 70880286) has the molecular formula C28H28IN7O2 and a molecular weight of 621.48 g/mol. Its IUPAC name is 1-benzyl-3-[2-[[5-iodo-2-(4-morpholin-4-ylanilino)pyrimidin-4-yl]amino]phenyl]urea.
| Compound Name | 1-benzyl-3-[2-[[5-iodo-2-(4-morpholin-4-ylanilino)pyrimidin-4-yl]amino]phenyl]urea |
|---|---|
| PubChem CID | 70880286 |
| Molecular Formula | C28H28IN7O2 |
| Molecular Weight | 621.48 g/mol |
| Exact Mass | 621.13 |
| IUPAC Name | 1-benzyl-3-[2-[[5-iodo-2-(4-morpholin-4-ylanilino)pyrimidin-4-yl]amino]phenyl]urea |
| SMILES | O=C(NCc1ccccc1)Nc1ccccc1Nc1nc(Nc2ccc(N3CCOCC3)cc2)ncc1I |
| InChI | InChI=1S/C28H28IN7O2/c29-23-19-30-27(32-21-10-12-22(13-11-21)36-14-16-38-17-15-36)35-26(23)33-24-8-4-5-9-25(24)34-28(37)31-18-20-6-2-1-3-7-20/h1-13,19H,14-18H2,(H2,31,34,37)(H2,30,32,33,35) |
| InChIKey | YGGSZQAYXPJMSH-UHFFFAOYSA-N |
| XLogP | 5.73 |
| TPSA | 103.44 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 621.48 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|