C20H18IN5O2 — CID 70880304
N-[2-[[2-(4-hydroxyanilino)-5-iodopyrimidin-4-yl]amino]phenyl]cyclopropanecarboxamide (PubChem CID 70880304) has the molecular formula C20H18IN5O2 and a molecular weight of 487.30 g/mol. Its IUPAC name is N-[2-[[2-(4-hydroxyanilino)-5-iodopyrimidin-4-yl]amino]phenyl]cyclopropanecarboxamide.
| Compound Name | N-[2-[[2-(4-hydroxyanilino)-5-iodopyrimidin-4-yl]amino]phenyl]cyclopropanecarboxamide |
|---|---|
| PubChem CID | 70880304 |
| Molecular Formula | C20H18IN5O2 |
| Molecular Weight | 487.30 g/mol |
| Exact Mass | 487.05 |
| IUPAC Name | N-[2-[[2-(4-hydroxyanilino)-5-iodopyrimidin-4-yl]amino]phenyl]cyclopropanecarboxamide |
| SMILES | O=C(Nc1ccccc1Nc1nc(Nc2ccc(O)cc2)ncc1I)C1CC1 |
| InChI | InChI=1S/C20H18IN5O2/c21-15-11-22-20(23-13-7-9-14(27)10-8-13)26-18(15)24-16-3-1-2-4-17(16)25-19(28)12-5-6-12/h1-4,7-12,27H,5-6H2,(H,25,28)(H2,22,23,24,26) |
| InChIKey | VVENMRLOTHEKIV-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 99.17 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.30 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|