C20H19IN6O — CID 89059562
N-[2-[[2-(4-aminoanilino)-5-iodopyrimidin-4-yl]amino]phenyl]cyclopropanecarboxamide (PubChem CID 89059562) has the molecular formula C20H19IN6O and a molecular weight of 486.32 g/mol. Its IUPAC name is N-[2-[[2-(4-aminoanilino)-5-iodopyrimidin-4-yl]amino]phenyl]cyclopropanecarboxamide.
| Compound Name | N-[2-[[2-(4-aminoanilino)-5-iodopyrimidin-4-yl]amino]phenyl]cyclopropanecarboxamide |
|---|---|
| PubChem CID | 89059562 |
| Molecular Formula | C20H19IN6O |
| Molecular Weight | 486.32 g/mol |
| Exact Mass | 486.07 |
| IUPAC Name | N-[2-[[2-(4-aminoanilino)-5-iodopyrimidin-4-yl]amino]phenyl]cyclopropanecarboxamide |
| SMILES | Nc1ccc(Nc2ncc(I)c(Nc3ccccc3NC(=O)C3CC3)n2)cc1 |
| InChI | InChI=1S/C20H19IN6O/c21-15-11-23-20(24-14-9-7-13(22)8-10-14)27-18(15)25-16-3-1-2-4-17(16)26-19(28)12-5-6-12/h1-4,7-12H,5-6,22H2,(H,26,28)(H2,23,24,25,27) |
| InChIKey | RPMJVPUTHQLLGA-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 104.96 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.32 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|