C27H24F2IN7O2 — CID 70880308
1-(2,5-difluorophenyl)-3-[2-[[5-iodo-2-(4-morpholin-4-ylanilino)pyrimidin-4-yl]amino]phenyl]urea (PubChem CID 70880308) has the molecular formula C27H24F2IN7O2 and a molecular weight of 643.44 g/mol. Its IUPAC name is 1-(2,5-difluorophenyl)-3-[2-[[5-iodo-2-(4-morpholin-4-ylanilino)pyrimidin-4-yl]amino]phenyl]urea.
| Compound Name | 1-(2,5-difluorophenyl)-3-[2-[[5-iodo-2-(4-morpholin-4-ylanilino)pyrimidin-4-yl]amino]phenyl]urea |
|---|---|
| PubChem CID | 70880308 |
| Molecular Formula | C27H24F2IN7O2 |
| Molecular Weight | 643.44 g/mol |
| Exact Mass | 643.10 |
| IUPAC Name | 1-(2,5-difluorophenyl)-3-[2-[[5-iodo-2-(4-morpholin-4-ylanilino)pyrimidin-4-yl]amino]phenyl]urea |
| SMILES | O=C(Nc1cc(F)ccc1F)Nc1ccccc1Nc1nc(Nc2ccc(N3CCOCC3)cc2)ncc1I |
| InChI | InChI=1S/C27H24F2IN7O2/c28-17-5-10-20(29)24(15-17)35-27(38)34-23-4-2-1-3-22(23)33-25-21(30)16-31-26(36-25)32-18-6-8-19(9-7-18)37-11-13-39-14-12-37/h1-10,15-16H,11-14H2,(H2,34,35,38)(H2,31,32,33,36) |
| InChIKey | MDVIYZZLCMFBPK-UHFFFAOYSA-N |
| XLogP | 6.33 |
| TPSA | 103.44 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 643.44 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|