C23H25FN6O3 — CID 118729110
2-[3-[[5-fluoro-4-(4-morpholin-4-ylanilino)pyrimidin-2-yl]amino]phenoxy]-N-methylacetamide (PubChem CID 118729110) has the molecular formula C23H25FN6O3 and a molecular weight of 452.49 g/mol. Its IUPAC name is 2-[3-[[5-fluoro-4-(4-morpholin-4-ylanilino)pyrimidin-2-yl]amino]phenoxy]-N-methylacetamide.
| Compound Name | 2-[3-[[5-fluoro-4-(4-morpholin-4-ylanilino)pyrimidin-2-yl]amino]phenoxy]-N-methylacetamide |
|---|---|
| PubChem CID | 118729110 |
| Molecular Formula | C23H25FN6O3 |
| Molecular Weight | 452.49 g/mol |
| Exact Mass | 452.20 |
| IUPAC Name | 2-[3-[[5-fluoro-4-(4-morpholin-4-ylanilino)pyrimidin-2-yl]amino]phenoxy]-N-methylacetamide |
| SMILES | CNC(=O)COc1cccc(Nc2ncc(F)c(Nc3ccc(N4CCOCC4)cc3)n2)c1 |
| InChI | InChI=1S/C23H25FN6O3/c1-25-21(31)15-33-19-4-2-3-17(13-19)28-23-26-14-20(24)22(29-23)27-16-5-7-18(8-6-16)30-9-11-32-12-10-30/h2-8,13-14H,9-12,15H2,1H3,(H,25,31)(H2,26,27,28,29) |
| InChIKey | PQFFXWQWRVUZBP-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 100.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.49 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|