C27H32ClN7O2 — CID 59363109
1-[2-[[5-chloro-2-(4-morpholin-4-ylanilino)pyrimidin-4-yl]amino]phenyl]-3-cyclohexylurea (PubChem CID 59363109) has the molecular formula C27H32ClN7O2 and a molecular weight of 522.05 g/mol. Its IUPAC name is 1-[2-[[5-chloro-2-(4-morpholin-4-ylanilino)pyrimidin-4-yl]amino]phenyl]-3-cyclohexylurea.
| Compound Name | 1-[2-[[5-chloro-2-(4-morpholin-4-ylanilino)pyrimidin-4-yl]amino]phenyl]-3-cyclohexylurea |
|---|---|
| PubChem CID | 59363109 |
| Molecular Formula | C27H32ClN7O2 |
| Molecular Weight | 522.05 g/mol |
| Exact Mass | 521.23 |
| IUPAC Name | 1-[2-[[5-chloro-2-(4-morpholin-4-ylanilino)pyrimidin-4-yl]amino]phenyl]-3-cyclohexylurea |
| SMILES | O=C(Nc1ccccc1Nc1nc(Nc2ccc(N3CCOCC3)cc2)ncc1Cl)NC1CCCCC1 |
| InChI | InChI=1S/C27H32ClN7O2/c28-22-18-29-26(30-20-10-12-21(13-11-20)35-14-16-37-17-15-35)34-25(22)32-23-8-4-5-9-24(23)33-27(36)31-19-6-2-1-3-7-19/h4-5,8-13,18-19H,1-3,6-7,14-17H2,(H2,31,33,36)(H2,29,30,32,34) |
| InChIKey | ONNSYBMFSLDITM-UHFFFAOYSA-N |
| XLogP | 5.91 |
| TPSA | 103.44 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.05 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|