C19H26N6O — CID 58786809
4-N-cyclopentyl-2-N-(4-morpholin-4-ylphenyl)pyrimidine-2,4,5-triamine (PubChem CID 58786809) has the molecular formula C19H26N6O and a molecular weight of 354.46 g/mol. Its IUPAC name is 4-N-cyclopentyl-2-N-(4-morpholin-4-ylphenyl)pyrimidine-2,4,5-triamine.
| Compound Name | 4-N-cyclopentyl-2-N-(4-morpholin-4-ylphenyl)pyrimidine-2,4,5-triamine |
|---|---|
| PubChem CID | 58786809 |
| Molecular Formula | C19H26N6O |
| Molecular Weight | 354.46 g/mol |
| Exact Mass | 354.22 |
| IUPAC Name | 4-N-cyclopentyl-2-N-(4-morpholin-4-ylphenyl)pyrimidine-2,4,5-triamine |
| SMILES | Nc1cnc(Nc2ccc(N3CCOCC3)cc2)nc1NC1CCCC1 |
| InChI | InChI=1S/C19H26N6O/c20-17-13-21-19(24-18(17)22-14-3-1-2-4-14)23-15-5-7-16(8-6-15)25-9-11-26-12-10-25/h5-8,13-14H,1-4,9-12,20H2,(H2,21,22,23,24) |
| InChIKey | CEUHFSAIWFAHQG-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 88.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.46 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|