C24H28N6OS — CID 164619227
4-N-cyclopentyl-2-N-(4-morpholin-4-ylphenyl)-5-(thiophen-2-ylmethylideneamino)pyrimidine-2,4-diamine (PubChem CID 164619227) has the molecular formula C24H28N6OS and a molecular weight of 448.60 g/mol. Its IUPAC name is 4-N-cyclopentyl-2-N-(4-morpholin-4-ylphenyl)-5-(thiophen-2-ylmethylideneamino)pyrimidine-2,4-diamine.
| Compound Name | 4-N-cyclopentyl-2-N-(4-morpholin-4-ylphenyl)-5-(thiophen-2-ylmethylideneamino)pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 164619227 |
| Molecular Formula | C24H28N6OS |
| Molecular Weight | 448.60 g/mol |
| Exact Mass | 448.20 |
| IUPAC Name | 4-N-cyclopentyl-2-N-(4-morpholin-4-ylphenyl)-5-(thiophen-2-ylmethylideneamino)pyrimidine-2,4-diamine |
| SMILES | C(=N/c1cnc(Nc2ccc(N3CCOCC3)cc2)nc1NC1CCCC1)\c1cccs1 |
| InChI | InChI=1S/C24H28N6OS/c1-2-5-18(4-1)27-23-22(25-16-21-6-3-15-32-21)17-26-24(29-23)28-19-7-9-20(10-8-19)30-11-13-31-14-12-30/h3,6-10,15-18H,1-2,4-5,11-14H2,(H2,26,27,28,29)/b25-16+ |
| InChIKey | BZWNZFFSUAFMCL-PCLIKHOPSA-N |
| XLogP | 5.22 |
| TPSA | 74.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.60 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|