C24H31N7 — CID 90466629
(E)-3-[4-(cyclohexylamino)-2-[4-(4-methylpiperazin-1-yl)anilino]pyrimidin-5-yl]prop-2-enenitrile (PubChem CID 90466629) has the molecular formula C24H31N7 and a molecular weight of 417.56 g/mol. Its IUPAC name is (E)-3-[4-(cyclohexylamino)-2-[4-(4-methylpiperazin-1-yl)anilino]pyrimidin-5-yl]prop-2-enenitrile.
| Compound Name | (E)-3-[4-(cyclohexylamino)-2-[4-(4-methylpiperazin-1-yl)anilino]pyrimidin-5-yl]prop-2-enenitrile |
|---|---|
| PubChem CID | 90466629 |
| Molecular Formula | C24H31N7 |
| Molecular Weight | 417.56 g/mol |
| Exact Mass | 417.26 |
| IUPAC Name | (E)-3-[4-(cyclohexylamino)-2-[4-(4-methylpiperazin-1-yl)anilino]pyrimidin-5-yl]prop-2-enenitrile |
| SMILES | CN1CCN(c2ccc(Nc3ncc(/C=C/C#N)c(NC4CCCCC4)n3)cc2)CC1 |
| InChI | InChI=1S/C24H31N7/c1-30-14-16-31(17-15-30)22-11-9-21(10-12-22)28-24-26-18-19(6-5-13-25)23(29-24)27-20-7-3-2-4-8-20/h5-6,9-12,18,20H,2-4,7-8,14-17H2,1H3,(H2,26,27,28,29)/b6-5+ |
| InChIKey | CZKKIZUGOANPHQ-AATRIKPKSA-N |
| XLogP | 4.25 |
| TPSA | 80.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.56 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|