C23H30N6OS — CID 156905925
4-[[2-[4-(4-methylpiperazin-1-yl)anilino]thieno[3,2-d]pyrimidin-4-yl]amino]cyclohexan-1-ol (PubChem CID 156905925) has the molecular formula C23H30N6OS and a molecular weight of 438.60 g/mol. Its IUPAC name is 4-[[2-[4-(4-methylpiperazin-1-yl)anilino]thieno[3,2-d]pyrimidin-4-yl]amino]cyclohexan-1-ol.
| Compound Name | 4-[[2-[4-(4-methylpiperazin-1-yl)anilino]thieno[3,2-d]pyrimidin-4-yl]amino]cyclohexan-1-ol |
|---|---|
| PubChem CID | 156905925 |
| Molecular Formula | C23H30N6OS |
| Molecular Weight | 438.60 g/mol |
| Exact Mass | 438.22 |
| IUPAC Name | 4-[[2-[4-(4-methylpiperazin-1-yl)anilino]thieno[3,2-d]pyrimidin-4-yl]amino]cyclohexan-1-ol |
| SMILES | CN1CCN(c2ccc(Nc3nc(NC4CCC(O)CC4)c4sccc4n3)cc2)CC1 |
| InChI | InChI=1S/C23H30N6OS/c1-28-11-13-29(14-12-28)18-6-2-17(3-7-18)25-23-26-20-10-15-31-21(20)22(27-23)24-16-4-8-19(30)9-5-16/h2-3,6-7,10,15-16,19,30H,4-5,8-9,11-14H2,1H3,(H2,24,25,26,27) |
| InChIKey | LQIVFLAVIIZMLL-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 76.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.60 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|